C21H23N3O4 — CID 43814291
2-N-(4-acetylphenyl)-1-N-(4-methoxyphenyl)pyrrolidine-1,2-dicarboxamide (PubChem CID 43814291) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is 2-N-(4-acetylphenyl)-1-N-(4-methoxyphenyl)pyrrolidine-1,2-dicarboxamide.
| Compound Name | 2-N-(4-acetylphenyl)-1-N-(4-methoxyphenyl)pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 43814291 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 2-N-(4-acetylphenyl)-1-N-(4-methoxyphenyl)pyrrolidine-1,2-dicarboxamide |
| SMILES | COc1ccc(NC(=O)N2CCCC2C(=O)Nc2ccc(C(C)=O)cc2)cc1 |
| InChI | InChI=1S/C21H23N3O4/c1-14(25)15-5-7-16(8-6-15)22-20(26)19-4-3-13-24(19)21(27)23-17-9-11-18(28-2)12-10-17/h5-12,19H,3-4,13H2,1-2H3,(H,22,26)(H,23,27) |
| InChIKey | ITVDPOOPMBHUPU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |