C21H24N4O4 — CID 1468944
(2R)-2-N-(4-acetamidophenyl)-1-N-(4-methoxyphenyl)pyrrolidine-1,2-dicarboxamide (PubChem CID 1468944) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is (2R)-2-N-(4-acetamidophenyl)-1-N-(4-methoxyphenyl)pyrrolidine-1,2-dicarboxamide.
| Compound Name | (2R)-2-N-(4-acetamidophenyl)-1-N-(4-methoxyphenyl)pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 1468944 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | (2R)-2-N-(4-acetamidophenyl)-1-N-(4-methoxyphenyl)pyrrolidine-1,2-dicarboxamide |
| SMILES | COc1ccc(NC(=O)N2CCC[C@@H]2C(=O)Nc2ccc(NC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C21H24N4O4/c1-14(26)22-15-5-7-16(8-6-15)23-20(27)19-4-3-13-25(19)21(28)24-17-9-11-18(29-2)12-10-17/h5-12,19H,3-4,13H2,1-2H3,(H,22,26)(H,23,27)(H,24,28)/t19-/m1/s1 |
| InChIKey | CKKDEYQAMITWLD-LJQANCHMSA-N |
| XLogP | 3.29 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |