C17H25N3O3 — CID 1468915
(2S)-2-N-tert-butyl-1-N-(4-methoxyphenyl)pyrrolidine-1,2-dicarboxamide (PubChem CID 1468915) has the molecular formula C17H25N3O3 and a molecular weight of 319.40 g/mol. Its IUPAC name is (2S)-2-N-tert-butyl-1-N-(4-methoxyphenyl)pyrrolidine-1,2-dicarboxamide.
| Compound Name | (2S)-2-N-tert-butyl-1-N-(4-methoxyphenyl)pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 1468915 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | (2S)-2-N-tert-butyl-1-N-(4-methoxyphenyl)pyrrolidine-1,2-dicarboxamide |
| SMILES | COc1ccc(NC(=O)N2CCC[C@H]2C(=O)NC(C)(C)C)cc1 |
| InChI | InChI=1S/C17H25N3O3/c1-17(2,3)19-15(21)14-6-5-11-20(14)16(22)18-12-7-9-13(23-4)10-8-12/h7-10,14H,5-6,11H2,1-4H3,(H,18,22)(H,19,21)/t14-/m0/s1 |
| InChIKey | YHPNHKYATZCZBQ-AWEZNQCLSA-N |
| XLogP | 2.61 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |