C24H29N3O5 — CID 42878811
(2R)-N-(3-benzamidopropyl)-1-(2,4-dimethoxybenzoyl)pyrrolidine-2-carboxamide (PubChem CID 42878811) has the molecular formula C24H29N3O5 and a molecular weight of 439.51 g/mol. Its IUPAC name is (2R)-N-(3-benzamidopropyl)-1-(2,4-dimethoxybenzoyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-(3-benzamidopropyl)-1-(2,4-dimethoxybenzoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 42878811 |
| Molecular Formula | C24H29N3O5 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | (2R)-N-(3-benzamidopropyl)-1-(2,4-dimethoxybenzoyl)pyrrolidine-2-carboxamide |
| SMILES | COc1ccc(C(=O)N2CCC[C@@H]2C(=O)NCCCNC(=O)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C24H29N3O5/c1-31-18-11-12-19(21(16-18)32-2)24(30)27-15-6-10-20(27)23(29)26-14-7-13-25-22(28)17-8-4-3-5-9-17/h3-5,8-9,11-12,16,20H,6-7,10,13-15H2,1-2H3,(H,25,28)(H,26,29)/t20-/m1/s1 |
| InChIKey | KRDCQRYOPTZPCT-HXUWFJFHSA-N |
| XLogP | 2.24 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|