About 1-(2,4-dimethoxybenzoyl)-N-[(4-hydroxypyrrolidin-3-yl)methyl]pyrrolidine-2-carboxamide
1-(2,4-dimethoxybenzoyl)-N-[(4-hydroxypyrrolidin-3-yl)methyl]pyrrolidine-2-carboxamide (PubChem CID 120945991) has the molecular formula C19H27N3O5
and a molecular weight of 377.44 g/mol. Its IUPAC name is 1-(2,4-dimethoxybenzoyl)-N-[(4-hydroxypyrrolidin-3-yl)methyl]pyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | 1-(2,4-dimethoxybenzoyl)-N-[(4-hydroxypyrrolidin-3-yl)methyl]pyrrolidine-2-carboxamide |
| PubChem CID | 120945991 |
| Molecular Formula | C19H27N3O5 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 1-(2,4-dimethoxybenzoyl)-N-[(4-hydroxypyrrolidin-3-yl)methyl]pyrrolidine-2-carboxamide |
| SMILES | COc1ccc(C(=O)N2CCCC2C(=O)NCC2CNCC2O)c(OC)c1 |
| InChI | InChI=1S/C19H27N3O5/c1-26-13-5-6-14(17(8-13)27-2)19(25)22-7-3-4-15(22)18(24)21-10-12-9-20-11-16(12)23/h5-6,8,12,15-16,20,23H,3-4,7,9-11H2,1-2H3,(H,21,24) |
| InChIKey | OWTQSZHEXMORDN-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(2,4-dimethoxybenzoyl)-N-[(4-hydroxypyrrolidin-3-yl)methyl]pyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-dimethoxybenzoyl)-N-[(4-hydroxypyrrolidin-3-yl)methyl]pyrrolidine-2-carboxamide?
The IUPAC name of 1-(2,4-dimethoxybenzoyl)-N-[(4-hydroxypyrrolidin-3-yl)methyl]pyrrolidine-2-carboxamide (CID 120945991) is 1-(2,4-dimethoxybenzoyl)-N-[(4-hydroxypyrrolidin-3-yl)methyl]pyrrolidine-2-carboxamide.
What is the SMILES notation for 1-(2,4-dimethoxybenzoyl)-N-[(4-hydroxypyrrolidin-3-yl)methyl]pyrrolidine-2-carboxamide?
The canonical SMILES for 1-(2,4-dimethoxybenzoyl)-N-[(4-hydroxypyrrolidin-3-yl)methyl]pyrrolidine-2-carboxamide is COc1ccc(C(=O)N2CCCC2C(=O)NCC2CNCC2O)c(OC)c1.
What is the InChIKey of 1-(2,4-dimethoxybenzoyl)-N-[(4-hydroxypyrrolidin-3-yl)methyl]pyrrolidine-2-carboxamide?
The InChIKey is OWTQSZHEXMORDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27N3O5/c1-26-13-5-6-14(17(8-13)27-2)19(25)22-7-3-4-15(22)18(24)21-10-12-9-20-11-16(12)23/h5-6,8,12,15-16,20,23H,3-4,7,9-11H2,1-2H3,(H,21,24).
What are the key properties of 1-(2,4-dimethoxybenzoyl)-N-[(4-hydroxypyrrolidin-3-yl)methyl]pyrrolidine-2-carboxamide?
1-(2,4-dimethoxybenzoyl)-N-[(4-hydroxypyrrolidin-3-yl)methyl]pyrrolidine-2-carboxamide has a molecular weight of 377.44 g/mol, XLogP of 0.00, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-dimethoxybenzoyl)-N-[(4-hydroxypyrrolidin-3-yl)methyl]pyrrolidine-2-carboxamide is sourced from PubChem (CID 120945991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).