C22H27NO4 — CID 55440342
(2,4-dimethoxyphenyl)-[2-(4-methoxyphenyl)azepan-1-yl]methanone (PubChem CID 55440342) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is (2,4-dimethoxyphenyl)-[2-(4-methoxyphenyl)azepan-1-yl]methanone.
| Compound Name | (2,4-dimethoxyphenyl)-[2-(4-methoxyphenyl)azepan-1-yl]methanone |
|---|---|
| PubChem CID | 55440342 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | (2,4-dimethoxyphenyl)-[2-(4-methoxyphenyl)azepan-1-yl]methanone |
| SMILES | COc1ccc(C2CCCCCN2C(=O)c2ccc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C22H27NO4/c1-25-17-10-8-16(9-11-17)20-7-5-4-6-14-23(20)22(24)19-13-12-18(26-2)15-21(19)27-3/h8-13,15,20H,4-7,14H2,1-3H3 |
| InChIKey | BHAARIRRPPZKOA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |