C22H25F2NO4 — CID 31796792
[4-(difluoromethoxy)-3-methoxyphenyl]-[(2R)-2-(4-methoxyphenyl)azepan-1-yl]methanone (PubChem CID 31796792) has the molecular formula C22H25F2NO4 and a molecular weight of 405.44 g/mol. Its IUPAC name is [4-(difluoromethoxy)-3-methoxyphenyl]-[(2R)-2-(4-methoxyphenyl)azepan-1-yl]methanone.
| Compound Name | [4-(difluoromethoxy)-3-methoxyphenyl]-[(2R)-2-(4-methoxyphenyl)azepan-1-yl]methanone |
|---|---|
| PubChem CID | 31796792 |
| Molecular Formula | C22H25F2NO4 |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | [4-(difluoromethoxy)-3-methoxyphenyl]-[(2R)-2-(4-methoxyphenyl)azepan-1-yl]methanone |
| SMILES | COc1ccc([C@H]2CCCCCN2C(=O)c2ccc(OC(F)F)c(OC)c2)cc1 |
| InChI | InChI=1S/C22H25F2NO4/c1-27-17-10-7-15(8-11-17)18-6-4-3-5-13-25(18)21(26)16-9-12-19(29-22(23)24)20(14-16)28-2/h7-12,14,18,22H,3-6,13H2,1-2H3/t18-/m1/s1 |
| InChIKey | ZJKJCMHIRCBFEQ-GOSISDBHSA-N |
| XLogP | 5.06 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |