C25H32N2O4 — CID 175293067
N-[4-[4-(2,4-dimethoxybenzoyl)piperidin-1-yl]butyl]benzamide (PubChem CID 175293067) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is N-[4-[4-(2,4-dimethoxybenzoyl)piperidin-1-yl]butyl]benzamide.
| Compound Name | N-[4-[4-(2,4-dimethoxybenzoyl)piperidin-1-yl]butyl]benzamide |
|---|---|
| PubChem CID | 175293067 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | N-[4-[4-(2,4-dimethoxybenzoyl)piperidin-1-yl]butyl]benzamide |
| SMILES | COc1ccc(C(=O)C2CCN(CCCCNC(=O)c3ccccc3)CC2)c(OC)c1 |
| InChI | InChI=1S/C25H32N2O4/c1-30-21-10-11-22(23(18-21)31-2)24(28)19-12-16-27(17-13-19)15-7-6-14-26-25(29)20-8-4-3-5-9-20/h3-5,8-11,18-19H,6-7,12-17H2,1-2H3,(H,26,29) |
| InChIKey | AXOCEAOHLDIUCV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|