C30H37N3O3 — CID 45484368
N-[4-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]butyl]-4-(2-methylphenyl)benzamide (PubChem CID 45484368) has the molecular formula C30H37N3O3 and a molecular weight of 487.64 g/mol. Its IUPAC name is N-[4-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]butyl]-4-(2-methylphenyl)benzamide.
| Compound Name | N-[4-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]butyl]-4-(2-methylphenyl)benzamide |
|---|---|
| PubChem CID | 45484368 |
| Molecular Formula | C30H37N3O3 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.28 |
| IUPAC Name | N-[4-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]butyl]-4-(2-methylphenyl)benzamide |
| SMILES | COc1ccc(N2CCN(CCCCNC(=O)c3ccc(-c4ccccc4C)cc3)CC2)c(OC)c1 |
| InChI | InChI=1S/C30H37N3O3/c1-23-8-4-5-9-27(23)24-10-12-25(13-11-24)30(34)31-16-6-7-17-32-18-20-33(21-19-32)28-15-14-26(35-2)22-29(28)36-3/h4-5,8-15,22H,6-7,16-21H2,1-3H3,(H,31,34) |
| InChIKey | QZLKOSYCBDWGRT-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|