C28H40FN3O5 — CID 51354851
4-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]benzamide (PubChem CID 51354851) has the molecular formula C28H40FN3O5 and a molecular weight of 517.64 g/mol. Its IUPAC name is 4-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]benzamide.
| Compound Name | 4-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]benzamide |
|---|---|
| PubChem CID | 51354851 |
| Molecular Formula | C28H40FN3O5 |
| Molecular Weight | 517.64 g/mol |
| Exact Mass | 517.30 |
| IUPAC Name | 4-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]benzamide |
| SMILES | COc1ccccc1N1CCN(CCCCNC(=O)c2ccc(OCCOCCOCCF)cc2)CC1 |
| InChI | InChI=1S/C28H40FN3O5/c1-34-27-7-3-2-6-26(27)32-17-15-31(16-18-32)14-5-4-13-30-28(33)24-8-10-25(11-9-24)37-23-22-36-21-20-35-19-12-29/h2-3,6-11H,4-5,12-23H2,1H3,(H,30,33) |
| InChIKey | HAXCDBIFKSGOTN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 72.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.64 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|