C30H33F3N4O3 — CID 44532094
N-[4-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butylcarbamoyl]phenyl]-4-(trifluoromethyl)benzamide (PubChem CID 44532094) has the molecular formula C30H33F3N4O3 and a molecular weight of 554.61 g/mol. Its IUPAC name is N-[4-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butylcarbamoyl]phenyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[4-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butylcarbamoyl]phenyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 44532094 |
| Molecular Formula | C30H33F3N4O3 |
| Molecular Weight | 554.61 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | N-[4-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butylcarbamoyl]phenyl]-4-(trifluoromethyl)benzamide |
| SMILES | COc1ccccc1N1CCN(CCCCNC(=O)c2ccc(NC(=O)c3ccc(C(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C30H33F3N4O3/c1-40-27-7-3-2-6-26(27)37-20-18-36(19-21-37)17-5-4-16-34-28(38)22-10-14-25(15-11-22)35-29(39)23-8-12-24(13-9-23)30(31,32)33/h2-3,6-15H,4-5,16-21H2,1H3,(H,34,38)(H,35,39) |
| InChIKey | MRFCEJIBWSAONR-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.61 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|