C26H34F3N3O2 — CID 163493568
N-[4-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]butyl]-2-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 163493568) has the molecular formula C26H34F3N3O2 and a molecular weight of 477.57 g/mol. Its IUPAC name is N-[4-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]butyl]-2-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[4-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]butyl]-2-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 163493568 |
| Molecular Formula | C26H34F3N3O2 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | N-[4-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]butyl]-2-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC(C)Oc1ccccc1N1CCN(CCCCNC(=O)Cc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C26H34F3N3O2/c1-20(2)34-24-8-4-3-7-23(24)32-17-15-31(16-18-32)14-6-5-13-30-25(33)19-21-9-11-22(12-10-21)26(27,28)29/h3-4,7-12,20H,5-6,13-19H2,1-2H3,(H,30,33) |
| InChIKey | COSHGDJJGOEFDO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|