C20H27N3O2S — CID 10248783
N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]thiophene-2-carboxamide (PubChem CID 10248783) has the molecular formula C20H27N3O2S and a molecular weight of 373.52 g/mol. Its IUPAC name is N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 10248783 |
| Molecular Formula | C20H27N3O2S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]thiophene-2-carboxamide |
| SMILES | COc1ccccc1N1CCN(CCCCNC(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C20H27N3O2S/c1-25-18-8-3-2-7-17(18)23-14-12-22(13-15-23)11-5-4-10-21-20(24)19-9-6-16-26-19/h2-3,6-9,16H,4-5,10-15H2,1H3,(H,21,24) |
| InChIKey | FJIKITBGGGDJBY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|