C20H24F3N3O2S — CID 139080265
N-[4-[4-[2-(trifluoromethoxy)phenyl]piperazin-1-yl]butyl]thiophene-2-carboxamide (PubChem CID 139080265) has the molecular formula C20H24F3N3O2S and a molecular weight of 427.49 g/mol. Its IUPAC name is N-[4-[4-[2-(trifluoromethoxy)phenyl]piperazin-1-yl]butyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[4-[2-(trifluoromethoxy)phenyl]piperazin-1-yl]butyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 139080265 |
| Molecular Formula | C20H24F3N3O2S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | N-[4-[4-[2-(trifluoromethoxy)phenyl]piperazin-1-yl]butyl]thiophene-2-carboxamide |
| SMILES | O=C(NCCCCN1CCN(c2ccccc2OC(F)(F)F)CC1)c1cccs1 |
| InChI | InChI=1S/C20H24F3N3O2S/c21-20(22,23)28-17-7-2-1-6-16(17)26-13-11-25(12-14-26)10-4-3-9-24-19(27)18-8-5-15-29-18/h1-2,5-8,15H,3-4,9-14H2,(H,24,27) |
| InChIKey | ZOUWKCBRIZEUJN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|