C22H25F3N4O4 — CID 42268855
N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-N'-[4-(trifluoromethoxy)phenyl]oxamide (PubChem CID 42268855) has the molecular formula C22H25F3N4O4 and a molecular weight of 466.46 g/mol. Its IUPAC name is N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-N'-[4-(trifluoromethoxy)phenyl]oxamide.
| Compound Name | N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-N'-[4-(trifluoromethoxy)phenyl]oxamide |
|---|---|
| PubChem CID | 42268855 |
| Molecular Formula | C22H25F3N4O4 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-N'-[4-(trifluoromethoxy)phenyl]oxamide |
| SMILES | COc1ccccc1N1CCN(CCNC(=O)C(=O)Nc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C22H25F3N4O4/c1-32-19-5-3-2-4-18(19)29-14-12-28(13-15-29)11-10-26-20(30)21(31)27-16-6-8-17(9-7-16)33-22(23,24)25/h2-9H,10-15H2,1H3,(H,26,30)(H,27,31) |
| InChIKey | DEDURENGHKXOQA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|