C23H30N4O4 — CID 42268804
N'-(2-methoxy-5-methylphenyl)-N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]oxamide (PubChem CID 42268804) has the molecular formula C23H30N4O4 and a molecular weight of 426.52 g/mol. Its IUPAC name is N'-(2-methoxy-5-methylphenyl)-N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]oxamide.
| Compound Name | N'-(2-methoxy-5-methylphenyl)-N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]oxamide |
|---|---|
| PubChem CID | 42268804 |
| Molecular Formula | C23H30N4O4 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | N'-(2-methoxy-5-methylphenyl)-N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]oxamide |
| SMILES | COc1ccc(C)cc1NC(=O)C(=O)NCCN1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C23H30N4O4/c1-17-8-9-20(30-2)18(16-17)25-23(29)22(28)24-10-11-26-12-14-27(15-13-26)19-6-4-5-7-21(19)31-3/h4-9,16H,10-15H2,1-3H3,(H,24,28)(H,25,29) |
| InChIKey | KEIAXOUZZWHASP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|