C21H25ClN4O3 — CID 42268915
N'-(2-chlorophenyl)-N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]oxamide (PubChem CID 42268915) has the molecular formula C21H25ClN4O3 and a molecular weight of 416.91 g/mol. Its IUPAC name is N'-(2-chlorophenyl)-N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]oxamide.
| Compound Name | N'-(2-chlorophenyl)-N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]oxamide |
|---|---|
| PubChem CID | 42268915 |
| Molecular Formula | C21H25ClN4O3 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | N'-(2-chlorophenyl)-N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]oxamide |
| SMILES | COc1ccccc1N1CCN(CCNC(=O)C(=O)Nc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C21H25ClN4O3/c1-29-19-9-5-4-8-18(19)26-14-12-25(13-15-26)11-10-23-20(27)21(28)24-17-7-3-2-6-16(17)22/h2-9H,10-15H2,1H3,(H,23,27)(H,24,28) |
| InChIKey | RWDGBSAQAIWXCO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|