C24H32N4O5 — CID 42389638
N'-(2,4-dimethoxyphenyl)-N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]oxamide (PubChem CID 42389638) has the molecular formula C24H32N4O5 and a molecular weight of 456.54 g/mol. Its IUPAC name is N'-(2,4-dimethoxyphenyl)-N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]oxamide.
| Compound Name | N'-(2,4-dimethoxyphenyl)-N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]oxamide |
|---|---|
| PubChem CID | 42389638 |
| Molecular Formula | C24H32N4O5 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | N'-(2,4-dimethoxyphenyl)-N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)NCCCN2CCN(c3ccccc3OC)CC2)c(OC)c1 |
| InChI | InChI=1S/C24H32N4O5/c1-31-18-9-10-19(22(17-18)33-3)26-24(30)23(29)25-11-6-12-27-13-15-28(16-14-27)20-7-4-5-8-21(20)32-2/h4-5,7-10,17H,6,11-16H2,1-3H3,(H,25,29)(H,26,30) |
| InChIKey | GVGVLIFJAAVIDV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|