C18H23FN4OS — CID 71293871
N-[4-[4-(6-fluoro-2-pyridinyl)piperazin-1-yl]butyl]thiophene-2-carboxamide (PubChem CID 71293871) has the molecular formula C18H23FN4OS and a molecular weight of 362.47 g/mol. Its IUPAC name is N-[4-[4-(6-fluoro-2-pyridinyl)piperazin-1-yl]butyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[4-(6-fluoro-2-pyridinyl)piperazin-1-yl]butyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 71293871 |
| Molecular Formula | C18H23FN4OS |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | N-[4-[4-(6-fluoro-2-pyridinyl)piperazin-1-yl]butyl]thiophene-2-carboxamide |
| SMILES | O=C(NCCCCN1CCN(c2cccc(F)n2)CC1)c1cccs1 |
| InChI | InChI=1S/C18H23FN4OS/c19-16-6-3-7-17(21-16)23-12-10-22(11-13-23)9-2-1-8-20-18(24)15-5-4-14-25-15/h3-7,14H,1-2,8-13H2,(H,20,24) |
| InChIKey | YWGXORNLLUUDRS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|