C21H29N5O2S — CID 86968886
N-[4-oxo-4-[1-(4-pyridin-2-ylpiperazin-1-yl)propan-2-ylamino]butyl]thiophene-2-carboxamide (PubChem CID 86968886) has the molecular formula C21H29N5O2S and a molecular weight of 415.56 g/mol. Its IUPAC name is N-[4-oxo-4-[1-(4-pyridin-2-ylpiperazin-1-yl)propan-2-ylamino]butyl]thiophene-2-carboxamide.
| Compound Name | N-[4-oxo-4-[1-(4-pyridin-2-ylpiperazin-1-yl)propan-2-ylamino]butyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 86968886 |
| Molecular Formula | C21H29N5O2S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | N-[4-oxo-4-[1-(4-pyridin-2-ylpiperazin-1-yl)propan-2-ylamino]butyl]thiophene-2-carboxamide |
| SMILES | CC(CN1CCN(c2ccccn2)CC1)NC(=O)CCCNC(=O)c1cccs1 |
| InChI | InChI=1S/C21H29N5O2S/c1-17(16-25-11-13-26(14-12-25)19-7-2-3-9-22-19)24-20(27)8-4-10-23-21(28)18-6-5-15-29-18/h2-3,5-7,9,15,17H,4,8,10-14,16H2,1H3,(H,23,28)(H,24,27) |
| InChIKey | QUINYHMZBXDGSD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|