C12H20ClN3OS — CID 119391130
N-(3-piperazin-1-ylpropyl)thiophene-2-carboxamide;hydrochloride (PubChem CID 119391130) has the molecular formula C12H20ClN3OS and a molecular weight of 289.83 g/mol. Its IUPAC name is N-(3-piperazin-1-ylpropyl)thiophene-2-carboxamide;hydrochloride.
| Compound Name | N-(3-piperazin-1-ylpropyl)thiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119391130 |
| Molecular Formula | C12H20ClN3OS |
| Molecular Weight | 289.83 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N-(3-piperazin-1-ylpropyl)thiophene-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCCN1CCNCC1)c1cccs1 |
| InChI | InChI=1S/C12H19N3OS.ClH/c16-12(11-3-1-10-17-11)14-4-2-7-15-8-5-13-6-9-15;/h1,3,10,13H,2,4-9H2,(H,14,16);1H |
| InChIKey | DYGGGOXQWZUWHB-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.83 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|