C17H25Cl2N5O2S2 — CID 119394325
N-[4-[2-oxo-2-(3-piperazin-1-ylpropylamino)ethyl]-1,3-thiazol-2-yl]thiophene-2-carboxamide;dihydrochloride (PubChem CID 119394325) has the molecular formula C17H25Cl2N5O2S2 and a molecular weight of 466.46 g/mol. Its IUPAC name is N-[4-[2-oxo-2-(3-piperazin-1-ylpropylamino)ethyl]-1,3-thiazol-2-yl]thiophene-2-carboxamide;dihydrochloride.
| Compound Name | N-[4-[2-oxo-2-(3-piperazin-1-ylpropylamino)ethyl]-1,3-thiazol-2-yl]thiophene-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119394325 |
| Molecular Formula | C17H25Cl2N5O2S2 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | N-[4-[2-oxo-2-(3-piperazin-1-ylpropylamino)ethyl]-1,3-thiazol-2-yl]thiophene-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(Cc1csc(NC(=O)c2cccs2)n1)NCCCN1CCNCC1 |
| InChI | InChI=1S/C17H23N5O2S2.2ClH/c23-15(19-4-2-7-22-8-5-18-6-9-22)11-13-12-26-17(20-13)21-16(24)14-3-1-10-25-14;;/h1,3,10,12,18H,2,4-9,11H2,(H,19,23)(H,20,21,24);2*1H |
| InChIKey | BIPWRXGUIADDAO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|