C16H30Cl2N4OS — CID 119394536
2-(2-tert-butyl-1,3-thiazol-4-yl)-N-(3-piperazin-1-ylpropyl)acetamide;dihydrochloride (PubChem CID 119394536) has the molecular formula C16H30Cl2N4OS and a molecular weight of 397.42 g/mol. Its IUPAC name is 2-(2-tert-butyl-1,3-thiazol-4-yl)-N-(3-piperazin-1-ylpropyl)acetamide;dihydrochloride.
| Compound Name | 2-(2-tert-butyl-1,3-thiazol-4-yl)-N-(3-piperazin-1-ylpropyl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119394536 |
| Molecular Formula | C16H30Cl2N4OS |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 2-(2-tert-butyl-1,3-thiazol-4-yl)-N-(3-piperazin-1-ylpropyl)acetamide;dihydrochloride |
| SMILES | CC(C)(C)c1nc(CC(=O)NCCCN2CCNCC2)cs1.Cl.Cl |
| InChI | InChI=1S/C16H28N4OS.2ClH/c1-16(2,3)15-19-13(12-22-15)11-14(21)18-5-4-8-20-9-6-17-7-10-20;;/h12,17H,4-11H2,1-3H3,(H,18,21);2*1H |
| InChIKey | HAVOQSUJHCNXHE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|