C19H27Cl2FN4OS — CID 119392498
2-[2-[(4-fluorophenyl)methyl]-1,3-thiazol-4-yl]-N-(3-piperazin-1-ylpropyl)acetamide;dihydrochloride (PubChem CID 119392498) has the molecular formula C19H27Cl2FN4OS and a molecular weight of 449.42 g/mol. Its IUPAC name is 2-[2-[(4-fluorophenyl)methyl]-1,3-thiazol-4-yl]-N-(3-piperazin-1-ylpropyl)acetamide;dihydrochloride.
| Compound Name | 2-[2-[(4-fluorophenyl)methyl]-1,3-thiazol-4-yl]-N-(3-piperazin-1-ylpropyl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119392498 |
| Molecular Formula | C19H27Cl2FN4OS |
| Molecular Weight | 449.42 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | 2-[2-[(4-fluorophenyl)methyl]-1,3-thiazol-4-yl]-N-(3-piperazin-1-ylpropyl)acetamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(Cc1csc(Cc2ccc(F)cc2)n1)NCCCN1CCNCC1 |
| InChI | InChI=1S/C19H25FN4OS.2ClH/c20-16-4-2-15(3-5-16)12-19-23-17(14-26-19)13-18(25)22-6-1-9-24-10-7-21-8-11-24;;/h2-5,14,21H,1,6-13H2,(H,22,25);2*1H |
| InChIKey | PPDQUUIYVGCWAB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|