C19H26Cl2N4O3S — CID 119394025
2-[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]-N-(3-piperazin-1-ylpropyl)acetamide;dihydrochloride (PubChem CID 119394025) has the molecular formula C19H26Cl2N4O3S and a molecular weight of 461.42 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]-N-(3-piperazin-1-ylpropyl)acetamide;dihydrochloride.
| Compound Name | 2-[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]-N-(3-piperazin-1-ylpropyl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119394025 |
| Molecular Formula | C19H26Cl2N4O3S |
| Molecular Weight | 461.42 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | 2-[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]-N-(3-piperazin-1-ylpropyl)acetamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(Cc1csc(-c2ccc3c(c2)OCO3)n1)NCCCN1CCNCC1 |
| InChI | InChI=1S/C19H24N4O3S.2ClH/c24-18(21-4-1-7-23-8-5-20-6-9-23)11-15-12-27-19(22-15)14-2-3-16-17(10-14)26-13-25-16;;/h2-3,10,12,20H,1,4-9,11,13H2,(H,21,24);2*1H |
| InChIKey | OKMLVHHACBQELA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|