C12H9NO4S — CID 43327447
2-[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]acetic acid (PubChem CID 43327447) has the molecular formula C12H9NO4S and a molecular weight of 263.27 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 43327447 |
| Molecular Formula | C12H9NO4S |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | 2-[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]acetic acid |
| SMILES | O=C(O)Cc1csc(-c2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C12H9NO4S/c14-11(15)4-8-5-18-12(13-8)7-1-2-9-10(3-7)17-6-16-9/h1-3,5H,4,6H2,(H,14,15) |
| InChIKey | ZYUQPTVVOCTKKL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |