2-[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]acetic acid

C12H9NO4S — CID 43327447

IUPAC2-[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]acetic acid
SMILESO=C(O)Cc1csc(-c2ccc3c(c2)OCO3)n1
InChIInChI=1S/C12H9NO4S/c14-11(15)4-8-5-18-12(13-8)7-1-2-9-10(3-7)17-6-16-9/h1-3,5H,4,6H2,(H,14,15)
InChIKeyZYUQPTVVOCTKKL-UHFFFAOYSA-N
MW263.27 g/mol
LogP2.17
Rot. Bonds3

About 2-[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]acetic acid

2-[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]acetic acid (PubChem CID 43327447) has the molecular formula C12H9NO4S and a molecular weight of 263.27 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]acetic acid.

Molecular Properties

Compound Name2-[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]acetic acid
PubChem CID43327447
Molecular FormulaC12H9NO4S
Molecular Weight263.27 g/mol
Exact Mass263.03
IUPAC Name2-[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]acetic acid
SMILESO=C(O)Cc1csc(-c2ccc3c(c2)OCO3)n1
InChIInChI=1S/C12H9NO4S/c14-11(15)4-8-5-18-12(13-8)7-1-2-9-10(3-7)17-6-16-9/h1-3,5H,4,6H2,(H,14,15)
InChIKeyZYUQPTVVOCTKKL-UHFFFAOYSA-N
XLogP2.17
TPSA68.65 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.27
LogP ≤ 52.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]acetic acid?
The IUPAC name of 2-[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]acetic acid (CID 43327447) is 2-[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]acetic acid.
What is the SMILES notation for 2-[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]acetic acid?
The canonical SMILES for 2-[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]acetic acid is O=C(O)Cc1csc(-c2ccc3c(c2)OCO3)n1.
What is the InChIKey of 2-[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]acetic acid?
The InChIKey is ZYUQPTVVOCTKKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO4S/c14-11(15)4-8-5-18-12(13-8)7-1-2-9-10(3-7)17-6-16-9/h1-3,5H,4,6H2,(H,14,15).
What are the key properties of 2-[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]acetic acid?
2-[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]acetic acid has a molecular weight of 263.27 g/mol, XLogP of 2.17, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1,3-benzodioxol-5-yl)-1,3-thiazol-4-yl]acetic acid is sourced from PubChem (CID 43327447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).