C11H7F2NO2S — CID 43658690
2-[2-(3,4-difluorophenyl)-1,3-thiazol-4-yl]acetic acid (PubChem CID 43658690) has the molecular formula C11H7F2NO2S and a molecular weight of 255.24 g/mol. Its IUPAC name is 2-[2-(3,4-difluorophenyl)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-(3,4-difluorophenyl)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 43658690 |
| Molecular Formula | C11H7F2NO2S |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | 2-[2-(3,4-difluorophenyl)-1,3-thiazol-4-yl]acetic acid |
| SMILES | O=C(O)Cc1csc(-c2ccc(F)c(F)c2)n1 |
| InChI | InChI=1S/C11H7F2NO2S/c12-8-2-1-6(3-9(8)13)11-14-7(5-17-11)4-10(15)16/h1-3,5H,4H2,(H,15,16) |
| InChIKey | YMZPOYXKTZBOSW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |