C14H12FNO3S — CID 159430012
5-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-4-oxopentanoic acid (PubChem CID 159430012) has the molecular formula C14H12FNO3S and a molecular weight of 293.32 g/mol. Its IUPAC name is 5-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-4-oxopentanoic acid.
| Compound Name | 5-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-4-oxopentanoic acid |
|---|---|
| PubChem CID | 159430012 |
| Molecular Formula | C14H12FNO3S |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 5-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-4-oxopentanoic acid |
| SMILES | O=C(O)CCC(=O)Cc1csc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C14H12FNO3S/c15-10-3-1-9(2-4-10)14-16-11(8-20-14)7-12(17)5-6-13(18)19/h1-4,8H,5-7H2,(H,18,19) |
| InChIKey | LQWBZMUZPMCAOF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |