C12H10FNOS — CID 115089550
1-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]propan-2-one (PubChem CID 115089550) has the molecular formula C12H10FNOS and a molecular weight of 235.28 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]propan-2-one.
| Compound Name | 1-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]propan-2-one |
|---|---|
| PubChem CID | 115089550 |
| Molecular Formula | C12H10FNOS |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | 1-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]propan-2-one |
| SMILES | CC(=O)Cc1csc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C12H10FNOS/c1-8(15)6-11-7-16-12(14-11)9-2-4-10(13)5-3-9/h2-5,7H,6H2,1H3 |
| InChIKey | VHMXCXYDRDZXDZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |