C11H8FNOS — CID 64542603
1-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]ethanone (PubChem CID 64542603) has the molecular formula C11H8FNOS and a molecular weight of 221.26 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]ethanone.
| Compound Name | 1-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]ethanone |
|---|---|
| PubChem CID | 64542603 |
| Molecular Formula | C11H8FNOS |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | 1-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]ethanone |
| SMILES | CC(=O)c1csc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C11H8FNOS/c1-7(14)10-6-15-11(13-10)8-2-4-9(12)5-3-8/h2-6H,1H3 |
| InChIKey | QDZMYTGHCJVODG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |