C10H7FN2OS — CID 79712444
1-[2-(5-fluoro-2-pyridinyl)-1,3-thiazol-4-yl]ethanone (PubChem CID 79712444) has the molecular formula C10H7FN2OS and a molecular weight of 222.24 g/mol. Its IUPAC name is 1-[2-(5-fluoro-2-pyridinyl)-1,3-thiazol-4-yl]ethanone.
| Compound Name | 1-[2-(5-fluoro-2-pyridinyl)-1,3-thiazol-4-yl]ethanone |
|---|---|
| PubChem CID | 79712444 |
| Molecular Formula | C10H7FN2OS |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | 1-[2-(5-fluoro-2-pyridinyl)-1,3-thiazol-4-yl]ethanone |
| SMILES | CC(=O)c1csc(-c2ccc(F)cn2)n1 |
| InChI | InChI=1S/C10H7FN2OS/c1-6(14)9-5-15-10(13-9)8-3-2-7(11)4-12-8/h2-5H,1H3 |
| InChIKey | HBWDCVNSOVIGSX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |