C14H10N2OS — CID 64542810
1-(2-quinolin-4-yl-1,3-thiazol-4-yl)ethanone (PubChem CID 64542810) has the molecular formula C14H10N2OS and a molecular weight of 254.31 g/mol. Its IUPAC name is 1-(2-quinolin-4-yl-1,3-thiazol-4-yl)ethanone.
| Compound Name | 1-(2-quinolin-4-yl-1,3-thiazol-4-yl)ethanone |
|---|---|
| PubChem CID | 64542810 |
| Molecular Formula | C14H10N2OS |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 1-(2-quinolin-4-yl-1,3-thiazol-4-yl)ethanone |
| SMILES | CC(=O)c1csc(-c2ccnc3ccccc23)n1 |
| InChI | InChI=1S/C14H10N2OS/c1-9(17)13-8-18-14(16-13)11-6-7-15-12-5-3-2-4-10(11)12/h2-8H,1H3 |
| InChIKey | CUAFLTYRLSSAMW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |