About 1-pyridin-2-ylethanone;quinoline
1-pyridin-2-ylethanone;quinoline (PubChem CID 175538468) has the molecular formula C16H14N2O
and a molecular weight of 250.30 g/mol. Its IUPAC name is 1-pyridin-2-ylethanone;quinoline.
Molecular Properties
| Compound Name | 1-pyridin-2-ylethanone;quinoline |
| PubChem CID | 175538468 |
| Molecular Formula | C16H14N2O |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 1-pyridin-2-ylethanone;quinoline |
| SMILES | CC(=O)c1ccccn1.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C7H7NO/c1-2-6-9-8(4-1)5-3-7-10-9;1-6(9)7-4-2-3-5-8-7/h1-7H;2-5H,1H3 |
| InChIKey | QQCWFGDHHKTGII-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-pyridin-2-ylethanone;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyridin-2-ylethanone;quinoline?
The IUPAC name of 1-pyridin-2-ylethanone;quinoline (CID 175538468) is 1-pyridin-2-ylethanone;quinoline.
What is the SMILES notation for 1-pyridin-2-ylethanone;quinoline?
The canonical SMILES for 1-pyridin-2-ylethanone;quinoline is CC(=O)c1ccccn1.c1ccc2ncccc2c1.
What is the InChIKey of 1-pyridin-2-ylethanone;quinoline?
The InChIKey is QQCWFGDHHKTGII-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C7H7NO/c1-2-6-9-8(4-1)5-3-7-10-9;1-6(9)7-4-2-3-5-8-7/h1-7H;2-5H,1H3.
What are the key properties of 1-pyridin-2-ylethanone;quinoline?
1-pyridin-2-ylethanone;quinoline has a molecular weight of 250.30 g/mol, XLogP of 3.52, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyridin-2-ylethanone;quinoline is sourced from PubChem (CID 175538468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).