molecular iodine;1-pyridin-2-ylethanone

C7H7I2NO — CID 169427217

IUPACmolecular iodine;1-pyridin-2-ylethanone
SMILESCC(=O)c1ccccn1.II
InChIInChI=1S/C7H7NO.I2/c1-6(9)7-4-2-3-5-8-7;1-2/h2-5H,1H3;
InChIKeyLUACTRNEBBGFIE-UHFFFAOYSA-N
MW374.95 g/mol
LogP3.06
Rot. Bonds1

About molecular iodine;1-pyridin-2-ylethanone

molecular iodine;1-pyridin-2-ylethanone (PubChem CID 169427217) has the molecular formula C7H7I2NO and a molecular weight of 374.95 g/mol. Its IUPAC name is molecular iodine;1-pyridin-2-ylethanone.

Molecular Properties

Compound Namemolecular iodine;1-pyridin-2-ylethanone
PubChem CID169427217
Molecular FormulaC7H7I2NO
Molecular Weight374.95 g/mol
Exact Mass374.86
IUPAC Namemolecular iodine;1-pyridin-2-ylethanone
SMILESCC(=O)c1ccccn1.II
InChIInChI=1S/C7H7NO.I2/c1-6(9)7-4-2-3-5-8-7;1-2/h2-5H,1H3;
InChIKeyLUACTRNEBBGFIE-UHFFFAOYSA-N
XLogP3.06
TPSA29.96 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500374.95
LogP ≤ 53.06
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze molecular iodine;1-pyridin-2-ylethanone with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of molecular iodine;1-pyridin-2-ylethanone?
The IUPAC name of molecular iodine;1-pyridin-2-ylethanone (CID 169427217) is molecular iodine;1-pyridin-2-ylethanone.
What is the SMILES notation for molecular iodine;1-pyridin-2-ylethanone?
The canonical SMILES for molecular iodine;1-pyridin-2-ylethanone is CC(=O)c1ccccn1.II.
What is the InChIKey of molecular iodine;1-pyridin-2-ylethanone?
The InChIKey is LUACTRNEBBGFIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO.I2/c1-6(9)7-4-2-3-5-8-7;1-2/h2-5H,1H3;.
What are the key properties of molecular iodine;1-pyridin-2-ylethanone?
molecular iodine;1-pyridin-2-ylethanone has a molecular weight of 374.95 g/mol, XLogP of 3.06, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for molecular iodine;1-pyridin-2-ylethanone is sourced from PubChem (CID 169427217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).