About molecular iodine;1-pyridin-2-ylethanone
molecular iodine;1-pyridin-2-ylethanone (PubChem CID 169427217) has the molecular formula C7H7I2NO
and a molecular weight of 374.95 g/mol. Its IUPAC name is molecular iodine;1-pyridin-2-ylethanone.
Molecular Properties
| Compound Name | molecular iodine;1-pyridin-2-ylethanone |
| PubChem CID | 169427217 |
| Molecular Formula | C7H7I2NO |
| Molecular Weight | 374.95 g/mol |
| Exact Mass | 374.86 |
| IUPAC Name | molecular iodine;1-pyridin-2-ylethanone |
| SMILES | CC(=O)c1ccccn1.II |
| InChI | InChI=1S/C7H7NO.I2/c1-6(9)7-4-2-3-5-8-7;1-2/h2-5H,1H3; |
| InChIKey | LUACTRNEBBGFIE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.95 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze molecular iodine;1-pyridin-2-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular iodine;1-pyridin-2-ylethanone?
The IUPAC name of molecular iodine;1-pyridin-2-ylethanone (CID 169427217) is molecular iodine;1-pyridin-2-ylethanone.
What is the SMILES notation for molecular iodine;1-pyridin-2-ylethanone?
The canonical SMILES for molecular iodine;1-pyridin-2-ylethanone is CC(=O)c1ccccn1.II.
What is the InChIKey of molecular iodine;1-pyridin-2-ylethanone?
The InChIKey is LUACTRNEBBGFIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO.I2/c1-6(9)7-4-2-3-5-8-7;1-2/h2-5H,1H3;.
What are the key properties of molecular iodine;1-pyridin-2-ylethanone?
molecular iodine;1-pyridin-2-ylethanone has a molecular weight of 374.95 g/mol, XLogP of 3.06, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for molecular iodine;1-pyridin-2-ylethanone is sourced from PubChem (CID 169427217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).