About acetyl bromide;pyridine-2-carboxamide
acetyl bromide;pyridine-2-carboxamide (PubChem CID 175817538) has the molecular formula C8H9BrN2O2
and a molecular weight of 245.08 g/mol. Its IUPAC name is acetyl bromide;pyridine-2-carboxamide.
Molecular Properties
| Compound Name | acetyl bromide;pyridine-2-carboxamide |
| PubChem CID | 175817538 |
| Molecular Formula | C8H9BrN2O2 |
| Molecular Weight | 245.08 g/mol |
| Exact Mass | 243.98 |
| IUPAC Name | acetyl bromide;pyridine-2-carboxamide |
| SMILES | CC(=O)Br.NC(=O)c1ccccn1 |
| InChI | InChI=1S/C6H6N2O.C2H3BrO/c7-6(9)5-3-1-2-4-8-5;1-2(3)4/h1-4H,(H2,7,9);1H3 |
| InChIKey | BVTQJTMDZHGYSB-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.08 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze acetyl bromide;pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl bromide;pyridine-2-carboxamide?
The IUPAC name of acetyl bromide;pyridine-2-carboxamide (CID 175817538) is acetyl bromide;pyridine-2-carboxamide.
What is the SMILES notation for acetyl bromide;pyridine-2-carboxamide?
The canonical SMILES for acetyl bromide;pyridine-2-carboxamide is CC(=O)Br.NC(=O)c1ccccn1.
What is the InChIKey of acetyl bromide;pyridine-2-carboxamide?
The InChIKey is BVTQJTMDZHGYSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O.C2H3BrO/c7-6(9)5-3-1-2-4-8-5;1-2(3)4/h1-4H,(H2,7,9);1H3.
What are the key properties of acetyl bromide;pyridine-2-carboxamide?
acetyl bromide;pyridine-2-carboxamide has a molecular weight of 245.08 g/mol, XLogP of 1.11, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl bromide;pyridine-2-carboxamide is sourced from PubChem (CID 175817538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).