About 1-methylpyrrol-2-amine;pyridine-2-carboxamide
1-methylpyrrol-2-amine;pyridine-2-carboxamide (PubChem CID 174903535) has the molecular formula C11H14N4O
and a molecular weight of 218.26 g/mol. Its IUPAC name is 1-methylpyrrol-2-amine;pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 1-methylpyrrol-2-amine;pyridine-2-carboxamide |
| PubChem CID | 174903535 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 1-methylpyrrol-2-amine;pyridine-2-carboxamide |
| SMILES | Cn1cccc1N.NC(=O)c1ccccn1 |
| InChI | InChI=1S/C6H6N2O.C5H8N2/c7-6(9)5-3-1-2-4-8-5;1-7-4-2-3-5(7)6/h1-4H,(H2,7,9);2-4H,6H2,1H3 |
| InChIKey | HSCOKJGHLZMXBK-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 86.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methylpyrrol-2-amine;pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpyrrol-2-amine;pyridine-2-carboxamide?
The IUPAC name of 1-methylpyrrol-2-amine;pyridine-2-carboxamide (CID 174903535) is 1-methylpyrrol-2-amine;pyridine-2-carboxamide.
What is the SMILES notation for 1-methylpyrrol-2-amine;pyridine-2-carboxamide?
The canonical SMILES for 1-methylpyrrol-2-amine;pyridine-2-carboxamide is Cn1cccc1N.NC(=O)c1ccccn1.
What is the InChIKey of 1-methylpyrrol-2-amine;pyridine-2-carboxamide?
The InChIKey is HSCOKJGHLZMXBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O.C5H8N2/c7-6(9)5-3-1-2-4-8-5;1-7-4-2-3-5(7)6/h1-4H,(H2,7,9);2-4H,6H2,1H3.
What are the key properties of 1-methylpyrrol-2-amine;pyridine-2-carboxamide?
1-methylpyrrol-2-amine;pyridine-2-carboxamide has a molecular weight of 218.26 g/mol, XLogP of 0.79, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpyrrol-2-amine;pyridine-2-carboxamide is sourced from PubChem (CID 174903535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).