About dioxane;pyridine-2-carboxamide
dioxane;pyridine-2-carboxamide (PubChem CID 174962613) has the molecular formula C10H14N2O3
and a molecular weight of 210.23 g/mol. Its IUPAC name is dioxane;pyridine-2-carboxamide.
Molecular Properties
| Compound Name | dioxane;pyridine-2-carboxamide |
| PubChem CID | 174962613 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | dioxane;pyridine-2-carboxamide |
| SMILES | C1CCOOC1.NC(=O)c1ccccn1 |
| InChI | InChI=1S/C6H6N2O.C4H8O2/c7-6(9)5-3-1-2-4-8-5;1-2-4-6-5-3-1/h1-4H,(H2,7,9);1-4H2 |
| InChIKey | MDANBZIQRZFOSL-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze dioxane;pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxane;pyridine-2-carboxamide?
The IUPAC name of dioxane;pyridine-2-carboxamide (CID 174962613) is dioxane;pyridine-2-carboxamide.
What is the SMILES notation for dioxane;pyridine-2-carboxamide?
The canonical SMILES for dioxane;pyridine-2-carboxamide is C1CCOOC1.NC(=O)c1ccccn1.
What is the InChIKey of dioxane;pyridine-2-carboxamide?
The InChIKey is MDANBZIQRZFOSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O.C4H8O2/c7-6(9)5-3-1-2-4-8-5;1-2-4-6-5-3-1/h1-4H,(H2,7,9);1-4H2.
What are the key properties of dioxane;pyridine-2-carboxamide?
dioxane;pyridine-2-carboxamide has a molecular weight of 210.23 g/mol, XLogP of 0.91, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dioxane;pyridine-2-carboxamide is sourced from PubChem (CID 174962613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).