About ethane;molecular hydrogen;pyridine-2-carboxamide
ethane;molecular hydrogen;pyridine-2-carboxamide (PubChem CID 145071770) has the molecular formula C8H14N2O
and a molecular weight of 154.21 g/mol. Its IUPAC name is ethane;molecular hydrogen;pyridine-2-carboxamide.
Molecular Properties
| Compound Name | ethane;molecular hydrogen;pyridine-2-carboxamide |
| PubChem CID | 145071770 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | ethane;molecular hydrogen;pyridine-2-carboxamide |
| SMILES | CC.NC(=O)c1ccccn1.[H][H] |
| InChI | InChI=1S/C6H6N2O.C2H6.H2/c7-6(9)5-3-1-2-4-8-5;1-2;/h1-4H,(H2,7,9);1-2H3;1H |
| InChIKey | HZCZBCQHOAANFV-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;molecular hydrogen;pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;molecular hydrogen;pyridine-2-carboxamide?
The IUPAC name of ethane;molecular hydrogen;pyridine-2-carboxamide (CID 145071770) is ethane;molecular hydrogen;pyridine-2-carboxamide.
What is the SMILES notation for ethane;molecular hydrogen;pyridine-2-carboxamide?
The canonical SMILES for ethane;molecular hydrogen;pyridine-2-carboxamide is CC.NC(=O)c1ccccn1.[H][H].
What is the InChIKey of ethane;molecular hydrogen;pyridine-2-carboxamide?
The InChIKey is HZCZBCQHOAANFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O.C2H6.H2/c7-6(9)5-3-1-2-4-8-5;1-2;/h1-4H,(H2,7,9);1-2H3;1H.
What are the key properties of ethane;molecular hydrogen;pyridine-2-carboxamide?
ethane;molecular hydrogen;pyridine-2-carboxamide has a molecular weight of 154.21 g/mol, XLogP of 1.45, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;molecular hydrogen;pyridine-2-carboxamide is sourced from PubChem (CID 145071770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).