About ethane;N'-methylpyridine-2-carboximidamide
ethane;N'-methylpyridine-2-carboximidamide (PubChem CID 143309787) has the molecular formula C9H15N3
and a molecular weight of 165.24 g/mol. Its IUPAC name is ethane;N'-methylpyridine-2-carboximidamide.
Molecular Properties
| Compound Name | ethane;N'-methylpyridine-2-carboximidamide |
| PubChem CID | 143309787 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | ethane;N'-methylpyridine-2-carboximidamide |
| SMILES | C/N=C(\N)c1ccccn1.CC |
| InChI | InChI=1S/C7H9N3.C2H6/c1-9-7(8)6-4-2-3-5-10-6;1-2/h2-5H,1H3,(H2,8,9);1-2H3 |
| InChIKey | XGBAVPLVXBXULY-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;N'-methylpyridine-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N'-methylpyridine-2-carboximidamide?
The IUPAC name of ethane;N'-methylpyridine-2-carboximidamide (CID 143309787) is ethane;N'-methylpyridine-2-carboximidamide.
What is the SMILES notation for ethane;N'-methylpyridine-2-carboximidamide?
The canonical SMILES for ethane;N'-methylpyridine-2-carboximidamide is C/N=C(\N)c1ccccn1.CC.
What is the InChIKey of ethane;N'-methylpyridine-2-carboximidamide?
The InChIKey is XGBAVPLVXBXULY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3.C2H6/c1-9-7(8)6-4-2-3-5-10-6;1-2/h2-5H,1H3,(H2,8,9);1-2H3.
What are the key properties of ethane;N'-methylpyridine-2-carboximidamide?
ethane;N'-methylpyridine-2-carboximidamide has a molecular weight of 165.24 g/mol, XLogP of 1.44, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N'-methylpyridine-2-carboximidamide is sourced from PubChem (CID 143309787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).