About pyridine-2-carbothioamide;hydrochloride
pyridine-2-carbothioamide;hydrochloride (PubChem CID 57440257) has the molecular formula C6H7ClN2S
and a molecular weight of 174.66 g/mol. Its IUPAC name is pyridine-2-carbothioamide;hydrochloride.
Molecular Properties
| Compound Name | pyridine-2-carbothioamide;hydrochloride |
| PubChem CID | 57440257 |
| Molecular Formula | C6H7ClN2S |
| Molecular Weight | 174.66 g/mol |
| Exact Mass | 174.00 |
| IUPAC Name | pyridine-2-carbothioamide;hydrochloride |
| SMILES | Cl.NC(=S)c1ccccn1 |
| InChI | InChI=1S/C6H6N2S.ClH/c7-6(9)5-3-1-2-4-8-5;/h1-4H,(H2,7,9);1H |
| InChIKey | BJMNJABFCIZZNB-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.66 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze pyridine-2-carbothioamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridine-2-carbothioamide;hydrochloride?
The IUPAC name of pyridine-2-carbothioamide;hydrochloride (CID 57440257) is pyridine-2-carbothioamide;hydrochloride.
What is the SMILES notation for pyridine-2-carbothioamide;hydrochloride?
The canonical SMILES for pyridine-2-carbothioamide;hydrochloride is Cl.NC(=S)c1ccccn1.
What is the InChIKey of pyridine-2-carbothioamide;hydrochloride?
The InChIKey is BJMNJABFCIZZNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2S.ClH/c7-6(9)5-3-1-2-4-8-5;/h1-4H,(H2,7,9);1H.
What are the key properties of pyridine-2-carbothioamide;hydrochloride?
pyridine-2-carbothioamide;hydrochloride has a molecular weight of 174.66 g/mol, XLogP of 1.14, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyridine-2-carbothioamide;hydrochloride is sourced from PubChem (CID 57440257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).