C14H14N4 — CID 145275038
(1Z,3Z)-1,4-dipyridin-2-ylbuta-1,3-diene-1,4-diamine (PubChem CID 145275038) has the molecular formula C14H14N4 and a molecular weight of 238.29 g/mol. Its IUPAC name is (1Z,3Z)-1,4-dipyridin-2-ylbuta-1,3-diene-1,4-diamine.
| Compound Name | (1Z,3Z)-1,4-dipyridin-2-ylbuta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 145275038 |
| Molecular Formula | C14H14N4 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (1Z,3Z)-1,4-dipyridin-2-ylbuta-1,3-diene-1,4-diamine |
| SMILES | N/C(=C\C=C(/N)c1ccccn1)c1ccccn1 |
| InChI | InChI=1S/C14H14N4/c15-11(13-5-1-3-9-17-13)7-8-12(16)14-6-2-4-10-18-14/h1-10H,15-16H2/b11-7-,12-8- |
| InChIKey | AGAOSORHDJHRNH-OXAWKVHCSA-N |
| XLogP | 1.78 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|