About 2-[(E)-1,2-dichloroethenyl]pyridine
2-[(E)-1,2-dichloroethenyl]pyridine (PubChem CID 146396959) has the molecular formula C7H5Cl2N
and a molecular weight of 174.03 g/mol. Its IUPAC name is 2-[(E)-1,2-dichloroethenyl]pyridine.
Molecular Properties
| Compound Name | 2-[(E)-1,2-dichloroethenyl]pyridine |
| PubChem CID | 146396959 |
| Molecular Formula | C7H5Cl2N |
| Molecular Weight | 174.03 g/mol |
| Exact Mass | 172.98 |
| IUPAC Name | 2-[(E)-1,2-dichloroethenyl]pyridine |
| SMILES | Cl/C=C(/Cl)c1ccccn1 |
| InChI | InChI=1S/C7H5Cl2N/c8-5-6(9)7-3-1-2-4-10-7/h1-5H/b6-5+ |
| InChIKey | SGJDCOZNCVKZCO-AATRIKPKSA-N |
| XLogP | 2.86 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.03 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[(E)-1,2-dichloroethenyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-1,2-dichloroethenyl]pyridine?
The IUPAC name of 2-[(E)-1,2-dichloroethenyl]pyridine (CID 146396959) is 2-[(E)-1,2-dichloroethenyl]pyridine.
What is the SMILES notation for 2-[(E)-1,2-dichloroethenyl]pyridine?
The canonical SMILES for 2-[(E)-1,2-dichloroethenyl]pyridine is Cl/C=C(/Cl)c1ccccn1.
What is the InChIKey of 2-[(E)-1,2-dichloroethenyl]pyridine?
The InChIKey is SGJDCOZNCVKZCO-AATRIKPKSA-N. The full InChI is InChI=1S/C7H5Cl2N/c8-5-6(9)7-3-1-2-4-10-7/h1-5H/b6-5+.
What are the key properties of 2-[(E)-1,2-dichloroethenyl]pyridine?
2-[(E)-1,2-dichloroethenyl]pyridine has a molecular weight of 174.03 g/mol, XLogP of 2.86, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-1,2-dichloroethenyl]pyridine is sourced from PubChem (CID 146396959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).