About ethane;pyridine-2-carbonyl chloride
ethane;pyridine-2-carbonyl chloride (PubChem CID 158598971) has the molecular formula C10H16ClNO
and a molecular weight of 201.70 g/mol. Its IUPAC name is ethane;pyridine-2-carbonyl chloride.
Molecular Properties
| Compound Name | ethane;pyridine-2-carbonyl chloride |
| PubChem CID | 158598971 |
| Molecular Formula | C10H16ClNO |
| Molecular Weight | 201.70 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | ethane;pyridine-2-carbonyl chloride |
| SMILES | CC.CC.O=C(Cl)c1ccccn1 |
| InChI | InChI=1S/C6H4ClNO.2C2H6/c7-6(9)5-3-1-2-4-8-5;2*1-2/h1-4H;2*1-2H3 |
| InChIKey | HVJSLIXLQIQEBM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.70 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze ethane;pyridine-2-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;pyridine-2-carbonyl chloride?
The IUPAC name of ethane;pyridine-2-carbonyl chloride (CID 158598971) is ethane;pyridine-2-carbonyl chloride.
What is the SMILES notation for ethane;pyridine-2-carbonyl chloride?
The canonical SMILES for ethane;pyridine-2-carbonyl chloride is CC.CC.O=C(Cl)c1ccccn1.
What is the InChIKey of ethane;pyridine-2-carbonyl chloride?
The InChIKey is HVJSLIXLQIQEBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClNO.2C2H6/c7-6(9)5-3-1-2-4-8-5;2*1-2/h1-4H;2*1-2H3.
What are the key properties of ethane;pyridine-2-carbonyl chloride?
ethane;pyridine-2-carbonyl chloride has a molecular weight of 201.70 g/mol, XLogP of 3.51, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;pyridine-2-carbonyl chloride is sourced from PubChem (CID 158598971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).