About CID 173156131
CID 173156131 (PubChem CID 173156131) has the molecular formula C12H10N2O4Se
and a molecular weight of 325.18 g/mol.
Molecular Properties
| Compound Name | CID 173156131 |
| PubChem CID | 173156131 |
| Molecular Formula | C12H10N2O4Se |
| Molecular Weight | 325.18 g/mol |
| Exact Mass | 325.98 |
| IUPAC Name | — |
| SMILES | O=C(O)c1ccccn1.O=C(O)c1ccccn1.[Se] |
| InChI | InChI=1S/2C6H5NO2.Se/c2*8-6(9)5-3-1-2-4-7-5;/h2*1-4H,(H,8,9); |
| InChIKey | JMPSGGQIFCTJFP-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.18 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 173156131 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173156131?
The IUPAC name of CID 173156131 (CID 173156131) is not available.
What is the SMILES notation for CID 173156131?
The canonical SMILES for CID 173156131 is O=C(O)c1ccccn1.O=C(O)c1ccccn1.[Se].
What is the InChIKey of CID 173156131?
The InChIKey is JMPSGGQIFCTJFP-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H5NO2.Se/c2*8-6(9)5-3-1-2-4-7-5;/h2*1-4H,(H,8,9);.
What are the key properties of CID 173156131?
CID 173156131 has a molecular weight of 325.18 g/mol, XLogP of 1.18, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173156131 is sourced from PubChem (CID 173156131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).