About sodium;pyridine-2-carboxylic acid;hydroxide
sodium;pyridine-2-carboxylic acid;hydroxide (PubChem CID 162223571) has the molecular formula C6H6NNaO3
and a molecular weight of 163.11 g/mol. Its IUPAC name is sodium;pyridine-2-carboxylic acid;hydroxide.
Molecular Properties
| Compound Name | sodium;pyridine-2-carboxylic acid;hydroxide |
| PubChem CID | 162223571 |
| Molecular Formula | C6H6NNaO3 |
| Molecular Weight | 163.11 g/mol |
| Exact Mass | 163.02 |
| IUPAC Name | sodium;pyridine-2-carboxylic acid;hydroxide |
| SMILES | O=C(O)c1ccccn1.[Na+].[OH-] |
| InChI | InChI=1S/C6H5NO2.Na.H2O/c8-6(9)5-3-1-2-4-7-5;;/h1-4H,(H,8,9);;1H2/q;+1;/p-1 |
| InChIKey | ZULLVVYTBDCWRI-UHFFFAOYSA-M |
| XLogP | -2.39 |
| TPSA | 80.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.11 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium;pyridine-2-carboxylic acid;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;pyridine-2-carboxylic acid;hydroxide?
The IUPAC name of sodium;pyridine-2-carboxylic acid;hydroxide (CID 162223571) is sodium;pyridine-2-carboxylic acid;hydroxide.
What is the SMILES notation for sodium;pyridine-2-carboxylic acid;hydroxide?
The canonical SMILES for sodium;pyridine-2-carboxylic acid;hydroxide is O=C(O)c1ccccn1.[Na+].[OH-].
What is the InChIKey of sodium;pyridine-2-carboxylic acid;hydroxide?
The InChIKey is ZULLVVYTBDCWRI-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H5NO2.Na.H2O/c8-6(9)5-3-1-2-4-7-5;;/h1-4H,(H,8,9);;1H2/q;+1;/p-1.
What are the key properties of sodium;pyridine-2-carboxylic acid;hydroxide?
sodium;pyridine-2-carboxylic acid;hydroxide has a molecular weight of 163.11 g/mol, XLogP of -2.39, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;pyridine-2-carboxylic acid;hydroxide is sourced from PubChem (CID 162223571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).