About oxovanadium;bis(pyridine-2-carboxylic acid)
oxovanadium;bis(pyridine-2-carboxylic acid) (PubChem CID 73357763) has the molecular formula C12H10N2O5V
and a molecular weight of 313.17 g/mol. Its IUPAC name is oxovanadium;bis(pyridine-2-carboxylic acid).
Molecular Properties
| Compound Name | oxovanadium;bis(pyridine-2-carboxylic acid) |
| PubChem CID | 73357763 |
| Molecular Formula | C12H10N2O5V |
| Molecular Weight | 313.17 g/mol |
| Exact Mass | 313.00 |
| IUPAC Name | oxovanadium;bis(pyridine-2-carboxylic acid) |
| SMILES | O=C(O)c1ccccn1.O=C(O)c1ccccn1.O=[V] |
| InChI | InChI=1S/2C6H5NO2.O.V/c2*8-6(9)5-3-1-2-4-7-5;;/h2*1-4H,(H,8,9);; |
| InChIKey | YRISQIRIVKXKBF-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 117.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.17 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze oxovanadium;bis(pyridine-2-carboxylic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxovanadium;bis(pyridine-2-carboxylic acid)?
The IUPAC name of oxovanadium;bis(pyridine-2-carboxylic acid) (CID 73357763) is oxovanadium;bis(pyridine-2-carboxylic acid).
What is the SMILES notation for oxovanadium;bis(pyridine-2-carboxylic acid)?
The canonical SMILES for oxovanadium;bis(pyridine-2-carboxylic acid) is O=C(O)c1ccccn1.O=C(O)c1ccccn1.O=[V].
What is the InChIKey of oxovanadium;bis(pyridine-2-carboxylic acid)?
The InChIKey is YRISQIRIVKXKBF-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H5NO2.O.V/c2*8-6(9)5-3-1-2-4-7-5;;/h2*1-4H,(H,8,9);;.
What are the key properties of oxovanadium;bis(pyridine-2-carboxylic acid)?
oxovanadium;bis(pyridine-2-carboxylic acid) has a molecular weight of 313.17 g/mol, XLogP of 1.44, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for oxovanadium;bis(pyridine-2-carboxylic acid) is sourced from PubChem (CID 73357763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).