europium;pyridine-2-carboxylic acid

C6H5EuNO2 — CID 174808227

IUPACeuropium;pyridine-2-carboxylic acid
SMILESO=C(O)c1ccccn1.[Eu]
InChIInChI=1S/C6H5NO2.Eu/c8-6(9)5-3-1-2-4-7-5;/h1-4H,(H,8,9);
InChIKeyIFCNASBTLYZCGL-UHFFFAOYSA-N
MW275.08 g/mol
LogP0.78
Rot. Bonds1

About europium;pyridine-2-carboxylic acid

europium;pyridine-2-carboxylic acid (PubChem CID 174808227) has the molecular formula C6H5EuNO2 and a molecular weight of 275.08 g/mol. Its IUPAC name is europium;pyridine-2-carboxylic acid.

Molecular Properties

Compound Nameeuropium;pyridine-2-carboxylic acid
PubChem CID174808227
Molecular FormulaC6H5EuNO2
Molecular Weight275.08 g/mol
Exact Mass275.95
IUPAC Nameeuropium;pyridine-2-carboxylic acid
SMILESO=C(O)c1ccccn1.[Eu]
InChIInChI=1S/C6H5NO2.Eu/c8-6(9)5-3-1-2-4-7-5;/h1-4H,(H,8,9);
InChIKeyIFCNASBTLYZCGL-UHFFFAOYSA-N
XLogP0.78
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.08
LogP ≤ 50.78
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze europium;pyridine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of europium;pyridine-2-carboxylic acid?
The IUPAC name of europium;pyridine-2-carboxylic acid (CID 174808227) is europium;pyridine-2-carboxylic acid.
What is the SMILES notation for europium;pyridine-2-carboxylic acid?
The canonical SMILES for europium;pyridine-2-carboxylic acid is O=C(O)c1ccccn1.[Eu].
What is the InChIKey of europium;pyridine-2-carboxylic acid?
The InChIKey is IFCNASBTLYZCGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2.Eu/c8-6(9)5-3-1-2-4-7-5;/h1-4H,(H,8,9);.
What are the key properties of europium;pyridine-2-carboxylic acid?
europium;pyridine-2-carboxylic acid has a molecular weight of 275.08 g/mol, XLogP of 0.78, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for europium;pyridine-2-carboxylic acid is sourced from PubChem (CID 174808227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).