About benzene;iridium;pyridine-2-carboxylic acid
benzene;iridium;pyridine-2-carboxylic acid (PubChem CID 175281168) has the molecular formula C12H10IrNO2-
and a molecular weight of 392.43 g/mol. Its IUPAC name is benzene;iridium;pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | benzene;iridium;pyridine-2-carboxylic acid |
| PubChem CID | 175281168 |
| Molecular Formula | C12H10IrNO2- |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | benzene;iridium;pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1ccccn1.[Ir].[c-]1ccccc1 |
| InChI | InChI=1S/C6H5NO2.C6H5.Ir/c8-6(9)5-3-1-2-4-7-5;1-2-4-6-5-3-1;/h1-4H,(H,8,9);1-5H;/q;-1; |
| InChIKey | MXQDYRLUPSFKJV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze benzene;iridium;pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;iridium;pyridine-2-carboxylic acid?
The IUPAC name of benzene;iridium;pyridine-2-carboxylic acid (CID 175281168) is benzene;iridium;pyridine-2-carboxylic acid.
What is the SMILES notation for benzene;iridium;pyridine-2-carboxylic acid?
The canonical SMILES for benzene;iridium;pyridine-2-carboxylic acid is O=C(O)c1ccccn1.[Ir].[c-]1ccccc1.
What is the InChIKey of benzene;iridium;pyridine-2-carboxylic acid?
The InChIKey is MXQDYRLUPSFKJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2.C6H5.Ir/c8-6(9)5-3-1-2-4-7-5;1-2-4-6-5-3-1;/h1-4H,(H,8,9);1-5H;/q;-1;.
What are the key properties of benzene;iridium;pyridine-2-carboxylic acid?
benzene;iridium;pyridine-2-carboxylic acid has a molecular weight of 392.43 g/mol, XLogP of 2.26, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;iridium;pyridine-2-carboxylic acid is sourced from PubChem (CID 175281168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).