About benzoic acid;copper(1+);bis(pyridine-2-carboxylic acid)
benzoic acid;copper(1+);bis(pyridine-2-carboxylic acid) (PubChem CID 161261554) has the molecular formula C19H15CuN2O6
and a molecular weight of 430.88 g/mol. Its IUPAC name is benzoic acid;copper(1+);bis(pyridine-2-carboxylic acid).
Molecular Properties
| Compound Name | benzoic acid;copper(1+);bis(pyridine-2-carboxylic acid) |
| PubChem CID | 161261554 |
| Molecular Formula | C19H15CuN2O6 |
| Molecular Weight | 430.88 g/mol |
| Exact Mass | 430.02 |
| IUPAC Name | benzoic acid;copper(1+);bis(pyridine-2-carboxylic acid) |
| SMILES | O=C(O)c1[c-]cccc1.O=C(O)c1ccccn1.O=C(O)c1ccccn1.[Cu+] |
| InChI | InChI=1S/C7H5O2.2C6H5NO2.Cu/c8-7(9)6-4-2-1-3-5-6;2*8-6(9)5-3-1-2-4-7-5;/h3*1-4H,(H,8,9);/q-1;;;+1 |
| InChIKey | LTTGYNZIUCMUFG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 137.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.88 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze benzoic acid;copper(1+);bis(pyridine-2-carboxylic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoic acid;copper(1+);bis(pyridine-2-carboxylic acid)?
The IUPAC name of benzoic acid;copper(1+);bis(pyridine-2-carboxylic acid) (CID 161261554) is benzoic acid;copper(1+);bis(pyridine-2-carboxylic acid).
What is the SMILES notation for benzoic acid;copper(1+);bis(pyridine-2-carboxylic acid)?
The canonical SMILES for benzoic acid;copper(1+);bis(pyridine-2-carboxylic acid) is O=C(O)c1[c-]cccc1.O=C(O)c1ccccn1.O=C(O)c1ccccn1.[Cu+].
What is the InChIKey of benzoic acid;copper(1+);bis(pyridine-2-carboxylic acid)?
The InChIKey is LTTGYNZIUCMUFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5O2.2C6H5NO2.Cu/c8-7(9)6-4-2-1-3-5-6;2*8-6(9)5-3-1-2-4-7-5;/h3*1-4H,(H,8,9);/q-1;;;+1.
What are the key properties of benzoic acid;copper(1+);bis(pyridine-2-carboxylic acid)?
benzoic acid;copper(1+);bis(pyridine-2-carboxylic acid) has a molecular weight of 430.88 g/mol, XLogP of 2.74, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid;copper(1+);bis(pyridine-2-carboxylic acid) is sourced from PubChem (CID 161261554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).