About propan-2-one;1-pyridin-2-ylethanone
propan-2-one;1-pyridin-2-ylethanone (PubChem CID 158043833) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is propan-2-one;1-pyridin-2-ylethanone.
Molecular Properties
| Compound Name | propan-2-one;1-pyridin-2-ylethanone |
| PubChem CID | 158043833 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | propan-2-one;1-pyridin-2-ylethanone |
| SMILES | CC(=O)c1ccccn1.CC(C)=O |
| InChI | InChI=1S/C7H7NO.C3H6O/c1-6(9)7-4-2-3-5-8-7;1-3(2)4/h2-5H,1H3;1-2H3 |
| InChIKey | FIRCEVFWLCVRJZ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propan-2-one;1-pyridin-2-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-one;1-pyridin-2-ylethanone?
The IUPAC name of propan-2-one;1-pyridin-2-ylethanone (CID 158043833) is propan-2-one;1-pyridin-2-ylethanone.
What is the SMILES notation for propan-2-one;1-pyridin-2-ylethanone?
The canonical SMILES for propan-2-one;1-pyridin-2-ylethanone is CC(=O)c1ccccn1.CC(C)=O.
What is the InChIKey of propan-2-one;1-pyridin-2-ylethanone?
The InChIKey is FIRCEVFWLCVRJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO.C3H6O/c1-6(9)7-4-2-3-5-8-7;1-3(2)4/h2-5H,1H3;1-2H3.
What are the key properties of propan-2-one;1-pyridin-2-ylethanone?
propan-2-one;1-pyridin-2-ylethanone has a molecular weight of 179.22 g/mol, XLogP of 1.88, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-one;1-pyridin-2-ylethanone is sourced from PubChem (CID 158043833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).